dehydroparadol
Modify Date: 2025-09-15 19:14:44
dehydroparadol structure
|
Common Name | dehydroparadol | ||
|---|---|---|---|---|
| CAS Number | 53172-10-4 | Molecular Weight | 276.37100 | |
| Density | 1.04g/cm3 | Boiling Point | 423.2ºC at 760mmHg | |
| Molecular Formula | C17H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.4ºC | |
| Name | (E)-1-(4-hydroxy-3-methoxyphenyl)dec-1-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 423.2ºC at 760mmHg |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.37100 |
| Flash Point | 148.4ºC |
| Exact Mass | 276.17300 |
| PSA | 46.53000 |
| LogP | 4.34360 |
| Index of Refraction | 1.538 |
| InChIKey | AXMBOMODZLJDKX-PKNBQFBNSA-N |
| SMILES | CCCCCCCC(=O)C=Cc1ccc(O)c(OC)c1 |
| HS Code | 2914509090 |
|---|
|
~%
dehydroparadol CAS#:53172-10-4 |
| Literature: Nomura; Tsurumi Proceedings of the Imperial Academy (Tokyo), vol. 2, p. 230 Sci. Rep. Tohoku Univ., Ser. 1: Phys., Chem., Astron., vol. 16, p. 570 Chem. Zentralbl., 1927 I,726;II,2186 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:27113-22-0| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Didehydro<6>paradol |
| 1-(4-hydroxy-3-methoxy-phenyl)-dec-1-en-3-one |
| 1-Decen-3-one,1-(4-hydroxy-3-methoxyphenyl) |
| Dehydroparadol |
| 1-Decen-3-one,1-(4-hydroxy-3-methoxyphenyl)-,(1E) |