Euscaphic acid structure
|
Common Name | Euscaphic acid | ||
|---|---|---|---|---|
| CAS Number | 53155-25-2 | Molecular Weight | 488.699 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 602.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O5 | Melting Point | 262-264℃ | |
| MSDS | N/A | Flash Point | 332.3±28.0 °C | |
Use of Euscaphic acidEuscaphic acid, a DNA polymerase inhibitor, is a triterpene from the root of the R. alceaefolius Poir. Euscaphic inhibits calf DNA polymerase α (pol α) and rat DNA polymerase β (pol β) with IC50 values of 61 and 108 μM[1]. Euscaphic acid induces apoptosis[2]. |
| Name | euscaphic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Euscaphic acid, a DNA polymerase inhibitor, is a triterpene from the root of the R. alceaefolius Poir. Euscaphic inhibits calf DNA polymerase α (pol α) and rat DNA polymerase β (pol β) with IC50 values of 61 and 108 μM[1]. Euscaphic acid induces apoptosis[2]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 61 μM (calf DNA polymerase α); 108 μM (rat DNA polymerase β)[1]; apoptosis[2] |
| In Vitro | Euscaphic acid induces apoptosis and cell cycle arrest in NPC cells by suppression of the PI3K/AKT/mTOR signaling pathway[2]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 602.7±55.0 °C at 760 mmHg |
| Melting Point | 262-264℃ |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.699 |
| Flash Point | 332.3±28.0 °C |
| Exact Mass | 488.350189 |
| PSA | 97.99000 |
| LogP | 6.21 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | OXVUXGFZHDKYLS-QUFHAEKXSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(C)C5CCC43C)C2C1(C)O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| Urs-12-en-28-oic acid, 2,3,19-trihydroxy-, (2α,3α)- |
| Jacarandic acid |
| (1R,2R,4aS,6aR,6aS,6bR,8aR,10S,11R,12aR,14bS)-1,10,11-trihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| 2α,3α,19α-Trihydroxyurs-12-en-28-oic acid |
| (2α,3α)-2,3,19-Trihydroxyurs-12-en-28-oic acid |
| tormentic acid |
| Euscaphic acid |
| 2,3,19-trihydroxyurs-12-en-28-oic acid |