Paramethasone
Modify Date: 2025-08-25 14:13:58
Paramethasone structure
|
Common Name | Paramethasone | ||
|---|---|---|---|---|
| CAS Number | 53-33-8 | Molecular Weight | 392.46100 | |
| Density | 1.32 g/cm3 | Boiling Point | 573.5ºC at 760 mmHg | |
| Molecular Formula | C22H29FO5 | Melting Point | 228-241ºC | |
| MSDS | N/A | Flash Point | 300.6ºC | |
Use of ParamethasoneParamethasone is an anti-inflammatory corticosteroid[1] |
| Name | Paramethasone |
|---|---|
| Synonym | More Synonyms |
| Description | Paramethasone is an anti-inflammatory corticosteroid[1] |
|---|---|
| Related Catalog | |
| References |
| Density | 1.32 g/cm3 |
|---|---|
| Boiling Point | 573.5ºC at 760 mmHg |
| Melting Point | 228-241ºC |
| Molecular Formula | C22H29FO5 |
| Molecular Weight | 392.46100 |
| Flash Point | 300.6ºC |
| Exact Mass | 392.20000 |
| PSA | 94.83000 |
| LogP | 1.75160 |
| Index of Refraction | 1.589 |
| InChIKey | MKPDWECBUAZOHP-AFYJWTTESA-N |
| SMILES | CC1CC2C3CC(F)C4=CC(=O)C=CC4(C)C3C(O)CC2(C)C1(O)C(=O)CO |
| Storage condition | 20°C |
| Hazard Codes | Xn |
|---|
| 16a-Methyl-6a-fluoroprednisolone |
| EINECS 200-169-2 |
| 6a-fluoro-11b,17a,21-trihydroxy-16a-methyl-1,4-pregnadiene-3,20-dione |
| Cortiden |
| 6a-Fluoro-16a-methylprednisolone |