(4-ETHOXYPHENYL)(4-METHOXYPHENYL)METHANONE
Modify Date: 2025-08-27 11:01:31
(4-ETHOXYPHENYL)(4-METHOXYPHENYL)METHANONE structure
|
Common Name | (4-ETHOXYPHENYL)(4-METHOXYPHENYL)METHANONE | ||
|---|---|---|---|---|
| CAS Number | 52886-92-7 | Molecular Weight | 256.29600 | |
| Density | 1.104g/cm3 | Boiling Point | 403.4ºC at 760 mmHg | |
| Molecular Formula | C16H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4ºC | |
| Name | (4-ethoxyphenyl)-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.104g/cm3 |
|---|---|
| Boiling Point | 403.4ºC at 760 mmHg |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.29600 |
| Flash Point | 189.4ºC |
| Exact Mass | 256.11000 |
| PSA | 35.53000 |
| LogP | 3.32490 |
| Index of Refraction | 1.55 |
| InChIKey | DXFSDXPGMHHSDI-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)c2ccc(OC)cc2)cc1 |
| HS Code | 2914509090 |
|---|
|
~17%
(4-ETHOXYPHENYL... CAS#:52886-92-7 |
| Literature: Gazit; Livshitz; Shani Steroids, 1987 , vol. 48, # 1-2 p. 73 - 84 |
|
~%
(4-ETHOXYPHENYL... CAS#:52886-92-7 |
| Literature: Schoenberg; Schuetz; Nickel Chemische Berichte, 1928 , vol. 61, p. 1383 |
|
~%
(4-ETHOXYPHENYL... CAS#:52886-92-7 |
| Literature: Tadros et al. Journal of the Chemical Society, 1958 , p. 4210 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Methanone,(4-ethoxyphenyl)(4-methoxyphenyl) |
| 4-Aethoxy-4'-methoxy-benzophenon |
| BENZOPHENONE,4-ETHOXY-4'-METHOXY |
| 4-ethoxy-4'-methoxy-benzophenone |
| 4-methoxy-4'-ethoxybenzophenone |