(4-BUTYLPHENYL)(4-METHOXYPHENYL)METHANONE
Modify Date: 2025-11-30 19:16:51
(4-BUTYLPHENYL)(4-METHOXYPHENYL)METHANONE structure
|
Common Name | (4-BUTYLPHENYL)(4-METHOXYPHENYL)METHANONE | ||
|---|---|---|---|---|
| CAS Number | 64357-38-6 | Molecular Weight | 268.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-butylphenyl)-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H20O2 |
|---|---|
| Molecular Weight | 268.35000 |
| Exact Mass | 268.14600 |
| PSA | 26.30000 |
| LogP | 4.26880 |
| InChIKey | WBCMGWCERMMYQS-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(C(=O)c2ccc(OC)cc2)cc1 |
| HS Code | 2914509090 |
|---|
|
~32%
(4-BUTYLPHENYL)... CAS#:64357-38-6 |
| Literature: Kubo, Kazuo; Ohyama, Shin-Ichi; Shimizu, Toshiyuki; Takami, Atsuya; Murooka, Hideko; Nishitoba, Tsuyoshi; Kato, Shinichiro; Yagi, Mikio; Kobayashi, Yoshiko; Iinuma, Noriko; Isoe, Toshiyuki; Nakamura, Kazuhide; Iijima, Hiroshi; Osawa, Tatsushi; Izawa, Toshio Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 23 p. 5117 - 5133 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-n-butylphenyl 4-methoxyphenyl ketone |
| 4-n-Butyl-4'-methoxy-benzophenon |