(4-ethoxyphenyl)-(4-methylphenyl)methanone structure
|
Common Name | (4-ethoxyphenyl)-(4-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 65629-84-7 | Molecular Weight | 240.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-ethoxyphenyl)-(4-methylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16O2 |
|---|---|
| Molecular Weight | 240.29700 |
| Exact Mass | 240.11500 |
| PSA | 26.30000 |
| LogP | 3.62470 |
| InChIKey | URYAPIPAPKZONE-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)c2ccc(C)cc2)cc1 |
|
~68%
(4-ethoxyphenyl... CAS#:65629-84-7 |
| Literature: Hatanaka, Yasuo; Hiyama, Tamejiro Chemistry Letters, 1989 , p. 2049 - 2052 |
|
~%
(4-ethoxyphenyl... CAS#:65629-84-7 |
| Literature: Bachmann; Ferguson Journal of the American Chemical Society, 1934 , vol. 56, p. 2081,2083 |
| (4-ethoxyphenyl)(4-methylphenyl)methanone |
| 4-Aethoxy-4'-methyl-benzophenon |
| 4-ethoxy-4'-methyl-benzophenone |
| (4-ethoxyphenyl)-(p-tolyl)-methanone |