Flucloxacillin
Modify Date: 2025-08-25 21:38:35
Flucloxacillin structure
|
Common Name | Flucloxacillin | ||
|---|---|---|---|---|
| CAS Number | 5250-39-5 | Molecular Weight | 453.872 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 677.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H17ClFN3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.4±31.5 °C | |
Use of FlucloxacillinFlucloxacillin is an active antibiotic against gram-positive and gram-negative bacteria[1][2]. |
| Name | flucloxacillin |
|---|---|
| Synonym | More Synonyms |
| Description | Flucloxacillin is an active antibiotic against gram-positive and gram-negative bacteria[1][2]. |
|---|---|
| Related Catalog | |
| In Vivo | Flucloxacillin (200 mg/kg; i.p.; three times/day, for 21 days; male Wistar rats) has effective against the most common bacterial strains in periprosthetic infection[1]. Animal Model: Male Wistar rats[1] Dosage: 200 mg/kg Administration: Intraperitoneal injection; three times/day, for 21 days Result: Reducted germs in the biofilm and in the bone tissue. |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 677.3±55.0 °C at 760 mmHg |
| Molecular Formula | C19H17ClFN3O5S |
| Molecular Weight | 453.872 |
| Flash Point | 363.4±31.5 °C |
| Exact Mass | 453.056152 |
| PSA | 138.04000 |
| LogP | 2.60 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | UIOFUWFRIANQPC-JKIFEVAISA-N |
| SMILES | Cc1onc(-c2c(F)cccc2Cl)c1C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O |
| Flucloxacillin |
| Floxapen |
| Culpen |
| (2S,5R,6R)-6-({[3-(2-chloro-6-fluorophenyl)-5-methylisoxazol-4-yl]carbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Flopen |
| (2S,5R,6R)-6-({[3-(2-Chloro-6-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]carbonyl}amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Abboflox |
| EINECS 226-051-0 |
| Flucil |
| 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[[[3-(2-chloro-6-fluorophenyl)-5-methyl-4-isoxazolyl]carbonyl]amino]-3,3-dimethyl-7-oxo-, (2S,5R,6R)- |
| Flupen |
| Ladropen |
| MFCD00864886 |
| Floxacillin |
| Staphcil |
| Staphylex |
| FK 900 |
| Penplus |
| Stafoxil |
| BRL 2039 |