Etocrilene structure
|
Common Name | Etocrilene | ||
|---|---|---|---|---|
| CAS Number | 5232-99-5 | Molecular Weight | 277.317 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 407.6±33.0 °C at 760 mmHg | |
| Molecular Formula | C18H15NO2 | Melting Point | 97-99 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 199.4±12.1 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | Ethyl 2-cyano-3,3-diphenylacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 407.6±33.0 °C at 760 mmHg |
| Melting Point | 97-99 °C(lit.) |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.317 |
| Flash Point | 199.4±12.1 °C |
| Exact Mass | 277.110291 |
| PSA | 50.09000 |
| LogP | 4.52 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | IAJNXBNRYMEYAZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)=C(c1ccccc1)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H410 |
| Precautionary Statements | P261-P273-P305 + P351 + P338-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38;R50/53 |
| Safety Phrases | S26-S36-S60-S61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | AT6200000 |
| Hazard Class | 9.0 |
| HS Code | 2926909090 |
|
~65%
Etocrilene CAS#:5232-99-5 |
| Literature: Gholap, Atul R.; Paul, Vincent; Srinivasan, Kumar V. Synthetic Communications, 2008 , vol. 38, # 17 p. 2967 - 2982 |
|
~%
Etocrilene CAS#:5232-99-5 |
| Literature: Charles Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1956 , vol. 242, p. 2468 |
|
Detail
|
| Literature: Cope et al. Journal of the American Chemical Society, 1941 , vol. 63, p. 3455 |
| Precursor 6 | |
|---|---|
| DownStream 4 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Ethyl α-cyan-β,β-diphenylacrylate |
| Ethyl α-cyano-β-phenylcinnamate |
| Etocrilene |
| MFCD00027364 |
| Ethyl 2-cyano-3,3-diphenylacrylate |
| Ethyl α-cyano-β,β-diphenylacrylate |
| 2-Propenoic acid, 2-cyano-3,3-diphenyl-, ethyl ester |
| EINECS 226-029-0 |
| 2-Cyano-3,3-diphenyl-2-propenoic acid ethyl ester |
| ethyl 2-cyano-3,3-diphenylprop-2-enoate |
| Acrylic acid, 2-cyano-3,3-diphenyl-, ethyl ester (8CI) |
| 2-Cyano-3,3-diphenylacrylic acid ethyl ester |