3-nitrobenzeneethanol structure
|
Common Name | 3-nitrobenzeneethanol | ||
|---|---|---|---|---|
| CAS Number | 52022-77-2 | Molecular Weight | 167.162 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 298.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | 47-50ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 142.8±9.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(3-nitrophenyl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 298.0±0.0 °C at 760 mmHg |
| Melting Point | 47-50ºC(lit.) |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.162 |
| Flash Point | 142.8±9.4 °C |
| Exact Mass | 167.058243 |
| PSA | 66.05000 |
| LogP | 1.09 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | PWZWTSYUZQZFKE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(CCO)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2906299090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Directed evolution of nitrobenzene dioxygenase for the synthesis of the antioxidant hydroxytyrosol.
Appl. Microbiol. Biotechnol. 98(11) , 4975-85, (2014) Nitrobenzene dioxygenase (NBDO) is known to add both atoms of molecular oxygen to the aromatic ring of nitrobenzene to form catechol. It is assembled by four subunits of which the alpha subunit is res... |
| 3-nitro-phenethyl alcohol |
| 3-Nitrophenethyl alcohol |
| MFCD00010445 |
| β-(m-Nitrophenyl)ethanol |
| 2-(3-Nitrophenyl)ethanol |
| Benzeneethanol, 3-nitro- |
| m-Nitrophenethyl alcohol |
| 3-Nitro-phenaethylalkohol |
| EINECS 257-611-2 |
| 3-nitrobenzeneethanol |
| Benzeneethanol,3-nitro |