3-Nitrobenzyl bromide structure
|
Common Name | 3-Nitrobenzyl bromide | ||
|---|---|---|---|---|
| CAS Number | 3958-57-4 | Molecular Weight | 216.032 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 300.9±17.0 °C at 760 mmHg | |
| Molecular Formula | C7H6BrNO2 | Melting Point | 58-59 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 135.8±20.9 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 3-Nitrobenzyl bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.9±17.0 °C at 760 mmHg |
| Melting Point | 58-59 °C(lit.) |
| Molecular Formula | C7H6BrNO2 |
| Molecular Weight | 216.032 |
| Flash Point | 135.8±20.9 °C |
| Exact Mass | 214.958176 |
| PSA | 45.82000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | LNWXALCHPJANMJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(CBr)c1 |
| Water Solubility | insoluble |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S27-S28-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
1,4-Disubstituted imidazoles are potential antibacterial agents functioning as inhibitors of enoyl acyl carrier protein reductase (FabI).
Bioorg. Med. Chem. Lett. 11(16) , 2061-5, (2001) 1,4-Disubstituted imidazole inhibitors of Staphylococcus aureus and Escherichia coli enoyl acyl carrier protein reductase (FabI) have been identified. Crystal structure data shows the inhibitor 1 boun... |
| 1-Bromomethyl-3-nitrobenzene |
| 3-Nitrobenzyl bromide |
| EINECS 223-557-3 |
| α-Bromo-m-nitrotoluene |
| 1-(Bromomethyl)-3-nitrobenzene |
| m-Nitro-α-bromotoluene |
| MFCD00007271 |
| Toluene, α-bromo-m-nitro- |
| Benzene, 1- (bromomethyl)-3-nitro- |
| Benzene, 1-(bromomethyl)-3-nitro- |
| α-Bromo-3-nitrotoluene |
| 3-Nitrobenzylbromide |