ESI 05 structure
|
Common Name | ESI 05 | ||
|---|---|---|---|---|
| CAS Number | 5184-64-5 | Molecular Weight | 274.37800 | |
| Density | 1.129g/cm3 | Boiling Point | 426.7ºC at 760mmHg | |
| Molecular Formula | C16H18O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250ºC | |
Use of ESI 05ESI-05 (NSC 116966) is a specific exchange protein directly activated by cAMP 2 (EPAC2) antagonist (IC50, 0.4 µM), suppresses the cAMP-mediated activation of EPAC2 and inhibits Rap1 activation mediated by EAPC2[1]. |
| Name | 1,3,5-trimethyl-2-(4-methylphenyl)sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Description | ESI-05 (NSC 116966) is a specific exchange protein directly activated by cAMP 2 (EPAC2) antagonist (IC50, 0.4 µM), suppresses the cAMP-mediated activation of EPAC2 and inhibits Rap1 activation mediated by EAPC2[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.4 µM (EPAC2)[1] |
| References |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 426.7ºC at 760mmHg |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.37800 |
| Flash Point | 250ºC |
| Exact Mass | 274.10300 |
| PSA | 42.52000 |
| LogP | 4.83380 |
| Index of Refraction | 1.562 |
| InChIKey | CGPHOZWFSFNOEQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)cc(C)cc2C)cc1 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| mesityl(4-methylphenyl) sulfone |