2-(dimethylaminomethyl)isoindole-1,3-dione structure
|
Common Name | 2-(dimethylaminomethyl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 51822-55-0 | Molecular Weight | 204.22500 | |
| Density | 1.245g/cm3 | Boiling Point | 303.3ºC at 760 mmHg | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128ºC | |
| Name | 2-[(dimethylamino)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 303.3ºC at 760 mmHg |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.22500 |
| Flash Point | 128ºC |
| Exact Mass | 204.09000 |
| PSA | 40.62000 |
| LogP | 0.73960 |
| Index of Refraction | 1.59 |
| InChIKey | RZDNXBOXSFUJAK-UHFFFAOYSA-N |
| SMILES | CN(C)CN1C(=O)c2ccccc2C1=O |
|
~%
2-(dimethylamin... CAS#:51822-55-0 |
| Literature: Atkinson Journal of the Chemical Society, 1954 , p. 1329 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| hms1531a11 |