2-(cinnamylideneamino)isoindole-1,3-dione structure
|
Common Name | 2-(cinnamylideneamino)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 32387-09-0 | Molecular Weight | 276.28900 | |
| Density | 1.19g/cm3 | Boiling Point | 464.9ºC at 760 mmHg | |
| Molecular Formula | C17H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235ºC | |
| Name | 2-[(E)-[(E)-3-phenylprop-2-enylidene]amino]isoindole-1,3-dione |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 464.9ºC at 760 mmHg |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.28900 |
| Flash Point | 235ºC |
| Exact Mass | 276.09000 |
| PSA | 49.74000 |
| LogP | 2.91970 |
| Index of Refraction | 1.628 |
| InChIKey | HDSHHVQNQMIVNO-YKYHQJSKSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1N=CC=Cc1ccccc1 |
|
~%
2-(cinnamyliden... CAS#:32387-09-0 |
| Literature: Drew; Hatt Journal of the Chemical Society, 1937 , p. 16,25 |
|
~%
2-(cinnamyliden... CAS#:32387-09-0 |
| Literature: Drew; Hatt Journal of the Chemical Society, 1937 , p. 16,25 |
|
~%
2-(cinnamyliden... CAS#:32387-09-0 |
| Literature: Drew; Hatt Journal of the Chemical Society, 1937 , p. 16,25 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |