2-Nitrophenyl Selenocyanate structure
|
Common Name | 2-Nitrophenyl Selenocyanate | ||
|---|---|---|---|---|
| CAS Number | 51694-22-5 | Molecular Weight | 227.07900 | |
| Density | N/A | Boiling Point | 345.2ºC at 760mmHg | |
| Molecular Formula | C7H4N2O2Se | Melting Point | 140-142 °C(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Nitrophenyl Selenocyanate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 345.2ºC at 760mmHg |
|---|---|
| Melting Point | 140-142 °C(lit.) |
| Molecular Formula | C7H4N2O2Se |
| Molecular Weight | 227.07900 |
| Exact Mass | 227.94400 |
| PSA | 69.61000 |
| LogP | 0.92858 |
| InChIKey | LHBLJWULWKQRON-UHFFFAOYSA-N |
| SMILES | N#C[Se]c1ccccc1[N+](=O)[O-] |
| Stability | Stable. Incompatible with acids, strong oxidizing agents. |
| Hazard Codes | T,N |
|---|---|
| Risk Phrases | 23/25-33-50/53 |
| Safety Phrases | S20/21-S28-S45-S60-S61 |
| RIDADR | UN 3282 6.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 2929909090 |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00043146 |
| 2-NITROPHENYL SELENOCYANATE |
| EINECS 257-350-4 |
| (2-nitrophenyl) selenocyanate |
| 2-Nitrophenylselenocyanate |