(3-Aminophenyl)(4-aminophenyl)methanone structure
|
Common Name | (3-Aminophenyl)(4-aminophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 51458-66-3 | Molecular Weight | 212.24700 | |
| Density | 1.233g/cm3 | Boiling Point | 461.8ºC at 760mmHg | |
| Molecular Formula | C13H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.1ºC | |
| Name | (3-aminophenyl)-(4-aminophenyl)methanone |
|---|
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 461.8ºC at 760mmHg |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.24700 |
| Flash Point | 233.1ºC |
| Exact Mass | 212.09500 |
| PSA | 69.11000 |
| LogP | 3.24440 |
| Index of Refraction | 1.673 |
| InChIKey | YKNMIGJJXKBHJE-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)c2cccc(N)c2)cc1 |
| HS Code | 2922399090 |
|---|
|
~%
(3-Aminophenyl)... CAS#:51458-66-3 |
| Literature: Mitsui Toatsu Chemicals, Inc. Patent: US4556738 A1, 1985 ; |
|
~%
(3-Aminophenyl)... CAS#:51458-66-3 |
| Literature: Gattermann; Ruedt Chemische Berichte, 1894 , vol. 27, p. 2296 |
|
~%
(3-Aminophenyl)... CAS#:51458-66-3 |
| Literature: Gattermann; Ruedt Chemische Berichte, 1894 , vol. 27, p. 2296 |
|
~%
(3-Aminophenyl)... CAS#:51458-66-3 |
| Literature: Gattermann; Ruedt Chemische Berichte, 1894 , vol. 27, p. 2296 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |