Arsinic acid,(3-aminophenyl)(4-aminophenyl)- (9CI) structure
|
Common Name | Arsinic acid,(3-aminophenyl)(4-aminophenyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 6973-89-3 | Molecular Weight | 292.16500 | |
| Density | N/A | Boiling Point | 587.7ºC at 760mmHg | |
| Molecular Formula | C12H13AsN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.2ºC | |
| Name | (3-aminophenyl)-(4-aminophenyl)arsinic acid |
|---|
| Boiling Point | 587.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H13AsN2O2 |
| Molecular Weight | 292.16500 |
| Flash Point | 309.2ºC |
| Exact Mass | 292.01900 |
| PSA | 89.34000 |
| LogP | 0.99260 |
| InChIKey | RCSJXXSVTOGORH-UHFFFAOYSA-N |
| SMILES | Nc1ccc([As](=O)(O)c2cccc(N)c2)cc1 |
|
~%
Arsinic acid,(3... CAS#:6973-89-3 |
| Literature: Blicke; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 534 |
|
~%
Arsinic acid,(3... CAS#:6973-89-3 |
| Literature: Blicke; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 534 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |