3,4-dihydroxy-2-nitrobenzaldehyde
Modify Date: 2025-09-13 10:49:07
3,4-dihydroxy-2-nitrobenzaldehyde structure
|
Common Name | 3,4-dihydroxy-2-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 50545-37-4 | Molecular Weight | 183.11800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-dihydroxy-2-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H5NO5 |
|---|---|
| Molecular Weight | 183.11800 |
| Exact Mass | 183.01700 |
| PSA | 103.35000 |
| LogP | 1.34170 |
| InChIKey | UICJHWULOYPREF-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(O)c(O)c1[N+](=O)[O-] |
| HS Code | 2913000090 |
|---|
|
~92%
3,4-dihydroxy-2... CAS#:50545-37-4 |
| Literature: Williams, Robert M.; Cushing, Timothy D. Tetrahedron Letters, 1990 , vol. 31, # 44 p. 6325 - 6328 |
|
~%
3,4-dihydroxy-2... CAS#:50545-37-4 |
| Literature: Hayduck Chemische Berichte, 1903 , vol. 36, p. 3528 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 3,4-dihydroxy-2-nitro-benzaldehyde |
| 3,4-Dihydroxy-2-nitrobenzaldehyd |
| 2-nitroprotocatechaldedyde |
| Benzaldehyde,3,4-dihydroxy-2-nitro |