(3,4-dihydroxy-2-methoxyphenyl)-phenylmethanone structure
|
Common Name | (3,4-dihydroxy-2-methoxyphenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 177703-29-6 | Molecular Weight | 244.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,4-dihydroxy-2-methoxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O4 |
|---|---|
| Molecular Weight | 244.24300 |
| Exact Mass | 244.07400 |
| PSA | 66.76000 |
| LogP | 2.33740 |
| InChIKey | GZENKJQOADZBBT-UHFFFAOYSA-N |
| SMILES | COc1c(C(=O)c2ccccc2)ccc(O)c1O |
|
~%
(3,4-dihydroxy-... CAS#:177703-29-6 |
| Literature: Burton, Michael Patent: US7531646 B2, 2009 ; Location in patent: Page/Page column 32 ; |
|
~%
(3,4-dihydroxy-... CAS#:177703-29-6 |
| Literature: Largeron, Martine; Langevin-Bermond, Dominique; Fleury, Maurice-Bernard Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1996 , # 5 p. 893 - 900 |
| 3,4-dihydroxy-2-methoxybenzophenone |