Rosuvastatin Lactone structure
|
Common Name | Rosuvastatin Lactone | ||
|---|---|---|---|---|
| CAS Number | 503610-43-3 | Molecular Weight | 463.522 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 695.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C22H26FN3O5S | Melting Point | 131℃ | |
| MSDS | N/A | Flash Point | 374.1±34.3 °C | |
Use of Rosuvastatin LactoneRosuvastatin lactone is a metabolite of Rosuvastatin (HY-17504A) (HMG-CoA inhibitor)[1]. |
| Name | Rosuvastatin Lactone |
|---|---|
| Synonym | More Synonyms |
| Description | Rosuvastatin lactone is a metabolite of Rosuvastatin (HY-17504A) (HMG-CoA inhibitor)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 695.0±65.0 °C at 760 mmHg |
| Melting Point | 131℃ |
| Molecular Formula | C22H26FN3O5S |
| Molecular Weight | 463.522 |
| Flash Point | 374.1±34.3 °C |
| Exact Mass | 463.157715 |
| PSA | 118.07000 |
| LogP | 0.42 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | SOEGVMSNJOCVHT-VEUZHWNKSA-N |
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1C=CC1CC(O)CC(=O)O1 |
| Storage condition | -20℃ |
| Methanesulfonamide, N-[4-(4-fluorophenyl)-6-(1-methylethyl)-5-[(E)-2-[(2S,4R)-tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl]ethenyl]-2-pyrimidinyl]-N-methyl- |
| RosuvastatinLactone |
| (3R,5R)-ROSUVASTATIN LACTONE |
| Rosuvastatin lactone |
| N-[4-(4-Fluorophenyl)-5-{(E)-2-[(2S,4R)-4-hydroxy-6-oxotetrahydro-2H-pyran-2-yl]vinyl}-6-isopropyl-2-pyrimidinyl]-N-methylmethanesulfonamide |
| ROSUVASTATIN-5S-LACTONE |