N-Methylflindersine structure
|
Common Name | N-Methylflindersine | ||
|---|---|---|---|---|
| CAS Number | 50333-13-6 | Molecular Weight | 241.285 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 365.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | 85℃ | |
| MSDS | N/A | Flash Point | 175.0±27.9 °C | |
Use of N-MethylflindersineN-Methylflindersine is a compound isolated as insect antifeedants from the East African Rutaceous medicinal plants Fagara chalybea and F. holtziana[1]. |
| Name | 2,2,6-trimethylpyrano[3,2-c]quinolin-5-one |
|---|---|
| Synonym | More Synonyms |
| Description | N-Methylflindersine is a compound isolated as insect antifeedants from the East African Rutaceous medicinal plants Fagara chalybea and F. holtziana[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.8±42.0 °C at 760 mmHg |
| Melting Point | 85℃ |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.285 |
| Flash Point | 175.0±27.9 °C |
| Exact Mass | 241.110275 |
| PSA | 31.23000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | RJZFGBNKPOVCHQ-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(c3ccccc31)OC(C)(C)C=C2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2,6-Trimethyl-2,6-dihydro-5H-pyrano[3,2-c]quinolin-5-one |
| 5H-Pyrano(3,2-c)quinolin-5-one, 2,6-dihydro-2,2,6-trimethyl- |
| N-methylfindersine |
| 2,6-Dihydro-2,2,6-trimethyl-5H-pyrano(3,2-c)quinolin-5-one |
| 5H-Pyrano[3,2-c]quinolin-5-one, 2,6-dihydro-2,2,6-trimethyl- |
| 2,2,6-trimethyl-2h,5h-pyrano[3,2-c]quinolin-5-one |
| N-methlyflindersin |
| 2,2,6-Trimethyl-2H,5H-pyrano(3,2-c)quinolin-5-one |
| methylflindersin |
| N-Methylflindersine |