5-(4-BROMOBENZYL)-4H-1,2,4-TRIAZOL-3-AMINE structure
|
Common Name | 5-(4-BROMOBENZYL)-4H-1,2,4-TRIAZOL-3-AMINE | ||
|---|---|---|---|---|
| CAS Number | 502685-91-8 | Molecular Weight | 253.09900 | |
| Density | 1.664 | Boiling Point | 492.1ºC at 760 mmHg | |
| Molecular Formula | C9H9BrN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.4ºC | |
| Name | 5-[(4-bromophenyl)methyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.664 |
|---|---|
| Boiling Point | 492.1ºC at 760 mmHg |
| Molecular Formula | C9H9BrN4 |
| Molecular Weight | 253.09900 |
| Flash Point | 251.4ºC |
| Exact Mass | 252.00100 |
| PSA | 68.32000 |
| LogP | 1.67030 |
| Index of Refraction | 1.689 |
| InChIKey | CTSHSORRMJZRRP-UHFFFAOYSA-N |
| SMILES | Nc1n[nH]c(Cc2ccc(Br)cc2)n1 |
|
~%
5-(4-BROMOBENZY... CAS#:502685-91-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 67, p. 325 - 334 |
|
~%
5-(4-BROMOBENZY... CAS#:502685-91-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 67, p. 325 - 334 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| A7459 |
| 5-(4-BROMOBENZYL)-4H-1,2,4-TRIAZOL-3-AMINE |
| 1H-1,2,4-Triazol-5-amine,3-[(4-bromophenyl)methyl] |