5-(4-BROMOPHENYL)-4H-1,2,4-TRIAZOL-3-AMINE structure
|
Common Name | 5-(4-BROMOPHENYL)-4H-1,2,4-TRIAZOL-3-AMINE | ||
|---|---|---|---|---|
| CAS Number | 54464-13-0 | Molecular Weight | 239.07200 | |
| Density | 1.732 | Boiling Point | 452.3ºC at 760 mmHg | |
| Molecular Formula | C8H7BrN4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 227.3ºC | |
| Name | 5-(4-bromophenyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.732 |
|---|---|
| Boiling Point | 452.3ºC at 760 mmHg |
| Molecular Formula | C8H7BrN4 |
| Molecular Weight | 239.07200 |
| Flash Point | 227.3ºC |
| Exact Mass | 237.98500 |
| PSA | 68.32000 |
| LogP | 1.74650 |
| Index of Refraction | 1.701 |
| InChIKey | VXTCEROZEXTJAB-UHFFFAOYSA-N |
| SMILES | Nc1n[nH]c(-c2ccc(Br)cc2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(4-bromo-phenyl)-1H-[1,2,4]triazol-3-ylamine |
| 5-(4-bromophenyl)-4H-1,2,4-triazol-3-amine |