Rilpivirine structure
|
Common Name | Rilpivirine | ||
|---|---|---|---|---|
| CAS Number | 500287-72-9 | Molecular Weight | 366.418 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 634.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C22H18N6 | Melting Point | 245ºC | |
| MSDS | N/A | Flash Point | 337.3±34.3 °C | |
Use of RilpivirineRilpivirine (R278474; TMC278) is a type of anti-HIV medicine called a non-nucleoside reverse transcriptase inhibitor (NNRTI). |
| Name | rilpivirine |
|---|---|
| Synonym | More Synonyms |
| Description | Rilpivirine (R278474; TMC278) is a type of anti-HIV medicine called a non-nucleoside reverse transcriptase inhibitor (NNRTI). |
|---|---|
| Related Catalog | |
| Target |
NNRTIs |
| In Vitro | Rilpivirine(TMC278) is a next-generation nonnucleoside reverse transcriptase inhibitor (NNRTI), active against wild-type and NNRTI-resistant HIV-1. NNRTIs work by binding to and blocking HIV reverse transcriptase, an HIV enzyme. This prevents HIV from replicating and lowers the amount of HIV in the blood. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 634.1±65.0 °C at 760 mmHg |
| Melting Point | 245ºC |
| Molecular Formula | C22H18N6 |
| Molecular Weight | 366.418 |
| Flash Point | 337.3±34.3 °C |
| Exact Mass | 366.159302 |
| PSA | 97.42000 |
| LogP | 3.63 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | YIBOMRUWOWDFLG-ONEGZZNKSA-N |
| SMILES | Cc1cc(C=CC#N)cc(C)c1Nc1ccnc(Nc2ccc(C#N)cc2)n1 |
| Storage condition | Refrigerator |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| [3H]-Rilpivirine |
| Edurant |
| Rilpivirine |
| TMC-278 |
| 4-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylanilino]pyrimidin-2-yl]amino]benzonitrile |
| 4-{[4-({4-[(E)-2-Cyanovinyl]-2,6-dimethylphenyl}amino)-2-pyrimidinyl]amino}benzonitrile |
| Benzonitrile, 4-[[4-[[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]amino]-2-pyrimidinyl]amino]- |
| UNII-FI96A8X663 |
| R 278474 |
| BENZONITRILE,4-((4-((4-((1E)-2-CYANOETHEN YL)-2,6-DIMETHYLPHENYL)AMINO)-2-PYRIMIDINYL)AMINO)-) |