Smilagenin acetate
Modify Date: 2025-09-29 18:21:13
Smilagenin acetate structure
|
Common Name | Smilagenin acetate | ||
|---|---|---|---|---|
| CAS Number | 4947-75-5 | Molecular Weight | 458.67300 | |
| Density | 1.11g/cm3 | Boiling Point | 527.5ºC at 760mmHg | |
| Molecular Formula | C29H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.8ºC | |
Use of Smilagenin acetateSmilagenin acetate is a Sapogenin derivative extracted from patent US20030004147A1. Smilagenin acetate increases the expression of acetylcholine m2 receptors and can be used for the research of dementia[1]. |
| Name | smilagenin, acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Smilagenin acetate is a Sapogenin derivative extracted from patent US20030004147A1. Smilagenin acetate increases the expression of acetylcholine m2 receptors and can be used for the research of dementia[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Smilagenin acetate increases the expression of m2 receptors on CHO cells transfected with DNA for the m2 receptor[1]. |
| References |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 527.5ºC at 760mmHg |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.67300 |
| Flash Point | 221.8ºC |
| Exact Mass | 458.34000 |
| PSA | 44.76000 |
| LogP | 6.36460 |
| InChIKey | LVRAKYNQYKVPIK-BSPYNPCNSA-N |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C3CC3OC4(CCC(C)CO4)C(C)C32)C1 |
| Storage condition | 2-8℃ |
| 25R,5BETA-SPIROSTAN-3BETA-OL 3-ACETATE |
| 3-O-acetylsarsasapogenin |
| Smilagenin Acetate |