Menthyl acetate structure
|
Common Name | Menthyl acetate | ||
|---|---|---|---|---|
| CAS Number | 29066-34-0 | Molecular Weight | 198.30200 | |
| Density | 0.922 | Boiling Point | 228-229ºC | |
| Molecular Formula | C12H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Menthyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.922 |
|---|---|
| Boiling Point | 228-229ºC |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.30200 |
| Exact Mass | 198.16200 |
| PSA | 26.30000 |
| LogP | 3.01030 |
| Vapour Pressure | 0.0707mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | XHXUANMFYXWVNG-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C1)OC(=O)C)C(C)C |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| acetic acid menthyl ester |