ARN272
Modify Date: 2025-12-01 18:35:32
ARN272 structure
|
Common Name | ARN272 | ||
|---|---|---|---|---|
| CAS Number | 488793-85-7 | Molecular Weight | 432.473 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 629.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.3±31.5 °C | |
Use of ARN272ARN272 is an anandamide transport inhibitor[1]. |
| Name | 4-{[4-(4-Hydroxyphenyl)-1-phthalazinyl]amino}-N-phenylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | ARN272 is an anandamide transport inhibitor[1]. |
|---|---|
| Related Catalog | |
| Target |
Anandamide transport[1] |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 629.1±55.0 °C at 760 mmHg |
| Molecular Formula | C27H20N4O2 |
| Molecular Weight | 432.473 |
| Flash Point | 334.3±31.5 °C |
| Exact Mass | 432.158630 |
| LogP | 4.58 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.757 |
| InChIKey | UPKNGUQNXSMHBE-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)c1ccc(Nc2nnc(-c3ccc(O)cc3)c3ccccc23)cc1 |
| Storage condition | 2-8℃ |
| Benzamide, 4-[[4-(4-hydroxyphenyl)-1-phthalazinyl]amino]-N-phenyl- |
| 4-{[4-(4-Hydroxyphenyl)-1-phthalazinyl]amino}-N-phenylbenzamide |