6-nitro-1,3-benzothiazole-2-thiol structure
|
Common Name | 6-nitro-1,3-benzothiazole-2-thiol | ||
|---|---|---|---|---|
| CAS Number | 4845-58-3 | Molecular Weight | 212.249 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 380.8±34.0 °C at 760 mmHg | |
| Molecular Formula | C7H4N2O2S2 | Melting Point | 249-253 °C | |
| MSDS | N/A | Flash Point | 184.1±25.7 °C | |
| Name | 2-Mercapto-6-Nitrobenzothiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 380.8±34.0 °C at 760 mmHg |
| Melting Point | 249-253 °C |
| Molecular Formula | C7H4N2O2S2 |
| Molecular Weight | 212.249 |
| Flash Point | 184.1±25.7 °C |
| Exact Mass | 211.971420 |
| PSA | 125.75000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.789 |
| InChIKey | QPOZGXKWWKLJDK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2[nH]c(=S)sc2c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S45-S36/37/39-S26 |
| RTECS | DL6600000 |
| HS Code | 2934999090 |
|
~0%
6-nitro-1,3-ben... CAS#:4845-58-3 |
| Literature: University of Iowa Research Foundation Patent: US4975448 A1, 1990 ; |
|
~94%
6-nitro-1,3-ben... CAS#:4845-58-3 |
| Literature: Huang, Wei; Tan, Ying; Ding, Ming-Wu; Yang, Guang-Fu Synthetic Communications, 2007 , vol. 37, # 3 p. 369 - 376 |
|
~54%
6-nitro-1,3-ben... CAS#:4845-58-3 |
| Literature: Kouge, Katsushige; Koizumi, Tatsuya; Ishibashi, Norio; Okai, Hideo Agricultural and Biological Chemistry, 1987 , vol. 51, # 7 p. 1941 - 1946 |
|
~%
Detail
|
| Literature: Scott; Watt Journal of Organic Chemistry, 1937 , vol. 2, p. 148,153 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Nitro-1,3-benzothiazole-2(3H)-thione |
| EINECS 204-405-5 |
| 2(3H)-Benzothiazolethione, 6-nitro- |
| 6-Nitrobenzo[d]thiazole-2-thiol |
| 6-Nitro-2-mercaptobenzothiazole |
| 6-nitro-1,3-benzothiazole-2-thiol |
| 2-benzothiazolethiol, 6-nitro- |
| 2-Mercapto-6-nitrobenzothiazole |
| 6-nitro-3H-1,3-benzothiazole-2-thione |
| MFCD00041850 |
| 6-Nitrobenzo[d]thiazole-2(3H)-thione |