Methyl-6-nitrobenzo-thiazolyl-2-sulfone
Modify Date: 2025-10-04 13:06:14
Methyl-6-nitrobenzo-thiazolyl-2-sulfone structure
|
Common Name | Methyl-6-nitrobenzo-thiazolyl-2-sulfone | ||
|---|---|---|---|---|
| CAS Number | 21554-41-6 | Molecular Weight | 258.27400 | |
| Density | 1.615g/cm3 | Boiling Point | 461.2ºC at 760 mmHg | |
| Molecular Formula | C8H6N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.8ºC | |
| Name | 2-methylsulfonyl-6-nitro-1,3-benzothiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.615g/cm3 |
|---|---|
| Boiling Point | 461.2ºC at 760 mmHg |
| Molecular Formula | C8H6N2O4S2 |
| Molecular Weight | 258.27400 |
| Flash Point | 232.8ºC |
| Exact Mass | 257.97700 |
| PSA | 129.47000 |
| LogP | 3.21200 |
| Vapour Pressure | 3E-08mmHg at 25°C |
| Index of Refraction | 1.67 |
| InChIKey | XZXMLEUCJADXIG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1nc2ccc([N+](=O)[O-])cc2s1 |
|
~%
Methyl-6-nitrob... CAS#:21554-41-6 |
| Literature: Suzuki; Kadoya; Dohmori Chemical and Pharmaceutical Bulletin, 1976 , vol. 24, # 5 p. 1050 - 1058 |
|
~%
Methyl-6-nitrob... CAS#:21554-41-6 |
| Literature: Cutter; Golden Journal of the American Chemical Society, 1947 , vol. 69, p. 831 |
|
~%
Methyl-6-nitrob... CAS#:21554-41-6 |
| Literature: Cutter; Golden Journal of the American Chemical Society, 1947 , vol. 69, p. 831 |
![6-nitro-2-[(6-nitro-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole structure](https://image.chemsrc.com/caspic/003/121579-06-4.png)
CAS#:28620-12-4
CAS#:34976-39-1| 2-Methylsulfonyl-6-nitrobenzothiazole |
| 2-methanesulfonyl-6-nitro-benzothiazole |
| 2-Methansulfonyl-6-nitro-benzothiazol |
| 2-Methylsulfonyl-6-nitrobenzothiazol |