(3β,13α)-Pimara-8(14),15-dien-3-ol structure
|
Common Name | (3β,13α)-Pimara-8(14),15-dien-3-ol | ||
|---|---|---|---|---|
| CAS Number | 4728-30-7 | Molecular Weight | 288.47 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 373.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C20H32O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.8±20.1 °C | |
Use of (3β,13α)-Pimara-8(14),15-dien-3-olSandaracopimaradien-3β-ol is a natural isopimarane-type diterpenoid[1]. |
| Name | (3β,13α)-Pimara-8(14),15-dien-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Sandaracopimaradien-3β-ol is a natural isopimarane-type diterpenoid[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 373.7±42.0 °C at 760 mmHg |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 |
| Flash Point | 160.8±20.1 °C |
| Exact Mass | 288.245331 |
| PSA | 20.23000 |
| LogP | 6.59 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | ATQOOBSXQVRQPY-VDWQKOAOSA-N |
| SMILES | C=CC1(C)C=C2CCC3C(C)(C)C(O)CCC3(C)C2CC1 |
| Hazard Codes | Xi |
|---|
| l-3-methylcyclopentanol |
| 2-Phenanthrenol, 7-ethenyl-1,2,3,4,4a,4b,5,6,7,9,10,10a-dodecahydro-1,1,4a,7-tetramethyl-, (2S,4aR,4bS,7R,10aR)- |
| Cyclopentanol,3-methyl |
| 3-methylcyclopentyl alcohol |
| 3-Methyl-1-cyclopentanol |
| (3β,13α)-Pimara-8(14),15-dien-3-ol |
| 3-methylcyclopentanol |
| 3-Methylcyclopentanol,mixture of isomers |
| Podocarp-8(14)-en-3β-ol, 13β-methyl-13-vinyl- |