Sordarin sodium structure
|
Common Name | Sordarin sodium | ||
|---|---|---|---|---|
| CAS Number | 463356-00-5 | Molecular Weight | 514.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H39NaO8 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Sordarin sodiumSordarin is a potent diphthamide-dependent eEF2 inhibitor with antifungal properties. Sordarin targets eEF2 so as to inhibit protein translation by blocking eEF2-mediated translocation of tRNAs. Sordarin inhibits translation specifically in certain fungi (e.g. C. albicans, C. glabrata, and C. neoformans) while unable to do so in some other fungal species (e.g. Candida parapsilosis and Candida lusitaniae)[1][2]. |
| Name | Sordarin sodium |
|---|
| Description | Sordarin is a potent diphthamide-dependent eEF2 inhibitor with antifungal properties. Sordarin targets eEF2 so as to inhibit protein translation by blocking eEF2-mediated translocation of tRNAs. Sordarin inhibits translation specifically in certain fungi (e.g. C. albicans, C. glabrata, and C. neoformans) while unable to do so in some other fungal species (e.g. Candida parapsilosis and Candida lusitaniae)[1][2]. |
|---|---|
| Related Catalog | |
| Target |
IC50: eEF2; fungal[1] |
| References |
| Molecular Formula | C27H39NaO8 |
|---|---|
| Molecular Weight | 514.58 |
| InChIKey | ILUKWKGTAAZHDW-IGICPMPSSA-M |
| SMILES | COC1C(C)OC(OCC23CC4C(C)CCC4C4(C=O)CC2C=C(C(C)C)C43C(=O)[O-])C(O)C1O.[Na+] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
|
Insights into diphthamide, key diphtheria toxin effector.
Toxins (Basel.) 5(5) , 958-68, (2013) Diphtheria toxin (DT) inhibits eukaryotic translation elongation factor 2 (eEF2) by ADP-ribosylation in a fashion that requires diphthamide, a modified histidine residue on eEF2. In budding yeast, dip... |