Ilicic acid structure
|
Common Name | Ilicic acid | ||
|---|---|---|---|---|
| CAS Number | 4586-68-9 | Molecular Weight | 252.349 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 399.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C15H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.5±19.7 °C | |
Use of Ilicic acidIlicic acid is a sesquiterpene lactones. Ilicic acid can be isolated Ambrosia camphorat[1]. |
| Name | Ilicic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ilicic acid is a sesquiterpene lactones. Ilicic acid can be isolated Ambrosia camphorat[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 399.4±25.0 °C at 760 mmHg |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.349 |
| Flash Point | 209.5±19.7 °C |
| Exact Mass | 252.172546 |
| PSA | 57.53000 |
| LogP | 3.45 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | FXKCXGBBUBCRPU-QHSBEEBCSA-N |
| SMILES | C=C(C(=O)O)C1CCC2(C)CCCC(C)(O)C2C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918199090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Naphthaleneacetic acid, decahydro-8-hydroxy-4a,8-dimethyl-α-methylene-, (2R,4aR,8R,8aR)- |
| 2-[(2R,4aR,8R,8aR)-8-Hydroxy-4a,8-dimethyldecahydro-2-naphthalenyl]acrylic acid |
| 2-[(2R,4aR,8R,8aR)-8-hydroxy-4a,8-dimethyldecahydronaphthalen-2-yl]prop-2-enoic acid |