D-Glutamic acid, 5-(1,1-dimethylethyl) ester structure
|
Common Name | D-Glutamic acid, 5-(1,1-dimethylethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 45125-00-6 | Molecular Weight | 203.236 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 336.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.3±26.5 °C | |
| Name | (R)-2-Amino-5-(tert-butoxy)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 336.4±37.0 °C at 760 mmHg |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.236 |
| Flash Point | 157.3±26.5 °C |
| Exact Mass | 203.115753 |
| PSA | 89.62000 |
| LogP | 1.03 |
| Appearance of Characters | Solid |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | OIOAKXPMBIZAHL-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)CCC(N)C(=O)O |
| Storage condition | -15°C |
| Water Solubility | Slightly soluble in water. |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| H-D-Glu(OtBu)-OH |
| D-Glutamic acid, 5-(1,1-dimethylethyl) ester |
| (2R)-2-Amino-5-tert-butoxy-5-oxopentanoic acid (non-preferred name) |
| (2R)-2-Amino-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid |
| (2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |