Boc-D-Glu(OtBu)-OH structure
|
Common Name | Boc-D-Glu(OtBu)-OH | ||
|---|---|---|---|---|
| CAS Number | 104719-63-3 | Molecular Weight | 303.351 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 449.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H25NO6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 225.8±27.3 °C | |
| Name | Boc-D-Glu(OtBu)-OH |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 449.8±40.0 °C at 760 mmHg |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.351 |
| Flash Point | 225.8±27.3 °C |
| Exact Mass | 303.168182 |
| PSA | 101.93000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.470 |
| InChIKey | YGSRAYJBEREVRB-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)CCC(NC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | N |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (R)-5-(tert-Butoxy)-2-((tert-butoxycarbonyl)amino)-5-oxopentanoic acid |
| MFCD00076927 |
| D-Glutamic acid, N-[(1,1-dimethylethoxy)carbonyl]-, 5-(1,1-dimethylethyl) ester |
| (2R)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| (2R)-5-[(2-Methyl-2-propanyl)oxy]-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid |
| Boc-Glu(OtBu)-OH; Boc-L-glutamic acid 5-tert-butyl ester |
| (2R)-5-tert-Butoxy-2-[(tert-butoxycarbonyl)amino]-5-oxopentanoic acid (non-preferred name) |