2-Methoxyl-5-pyridineboronic acid pinacol ester structure
|
Common Name | 2-Methoxyl-5-pyridineboronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 445264-61-9 | Molecular Weight | 235.087 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 321.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C12H18BNO3 | Melting Point | 47-51 °C(lit.) | |
| MSDS | N/A | Flash Point | 148.4±23.7 °C | |
| Name | 2-Methoxypyridine-5-boronic acid pinacol ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 321.8±27.0 °C at 760 mmHg |
| Melting Point | 47-51 °C(lit.) |
| Molecular Formula | C12H18BNO3 |
| Molecular Weight | 235.087 |
| Flash Point | 148.4±23.7 °C |
| Exact Mass | 235.137970 |
| PSA | 40.58000 |
| LogP | 1.38940 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | QOGNDJLSYMJGPP-UHFFFAOYSA-N |
| SMILES | COc1ccc(B2OC(C)(C)C(C)(C)O2)cn1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | S26 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
|
~68%
2-Methoxyl-5-py... CAS#:445264-61-9 |
| Literature: US2005/192310 A1, ; Page/Page column 21 ; |
|
~10%
2-Methoxyl-5-py... CAS#:445264-61-9 |
| Literature: Synthesis, , vol. 44, # 5 p. 735 - 746 |
|
~49%
2-Methoxyl-5-py... CAS#:445264-61-9 |
| Literature: Journal of Organic Chemistry, , vol. 78, # 5 p. 1923 - 1933 |
|
~%
2-Methoxyl-5-py... CAS#:445264-61-9 |
| Literature: Journal of the American Chemical Society, , vol. 136, # 11 p. 4133 - 4136 |
|
~%
2-Methoxyl-5-py... CAS#:445264-61-9 |
| Literature: Synthesis, , vol. 44, # 5 p. 735 - 746 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD05663858 |
| 6-Methoxy-3-pyridylboronic Acid Pinacol Ester |
| Pyridine, 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |
| 6-Methoxypyridine-3-boronic acid pinacol ester |
| 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| 2-(6-Methoxy-3-pyridyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| 2-Methoxyl-5-pyridineboronic acid pinacol ester |