2,2',3,3',4,4',5,6,6'-nonabde structure
|
Common Name | 2,2',3,3',4,4',5,6,6'-nonabde | ||
|---|---|---|---|---|
| CAS Number | 437701-79-6 | Molecular Weight | 880.272 | |
| Density | 2.9±0.1 g/cm3 | Boiling Point | 541.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C12HBr9O | Melting Point | N/A | |
| MSDS | USA | Flash Point | 227.8±28.6 °C | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 1,2,3,4,5-Pentabromo-6-(2,3,4,6-tetrabromophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 541.6±50.0 °C at 760 mmHg |
| Molecular Formula | C12HBr9O |
| Molecular Weight | 880.272 |
| Flash Point | 227.8±28.6 °C |
| Exact Mass | 871.267700 |
| PSA | 9.23000 |
| LogP | 10.62 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.729 |
| InChIKey | IEEVDIAVLGLVOW-UHFFFAOYSA-N |
| SMILES | Brc1cc(Br)c(Oc2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c1Br |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H304-H315-H336-H410 |
| Precautionary Statements | P210-P261-P273-P301 + P310-P331-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,N |
| Risk Phrases | 11-38-50/53-65-67 |
| Safety Phrases | 9-16-29-33-60-61-62 |
| RIDADR | UN 1262 3/PG 2 |
|
~0%
2,2',3,3',4,4',... CAS#:437701-79-6
Detail
|
| Literature: ALBEMARLE CORPORATION Patent: WO2008/27776 A2, 2008 ; Location in patent: Page/Page column 8-9 ; |
|
~0%
2,2',3,3',4,4',... CAS#:437701-79-6 |
| Literature: ALBEMARLE CORPORATION Patent: WO2008/27776 A2, 2008 ; Location in patent: Page/Page column 9-10 ; |
|
~%
2,2',3,3',4,4',... CAS#:437701-79-6 |
| Literature: Eriksson, Johan; Green, Nicholas; Marsh, Goeran; Bergman, Ake Environmental Science and Technology, 2004 , vol. 38, # 11 p. 3119 - 3125 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2',3,3',4,4',5,6,6'-nonabromodiphenyl ether |
| PBDE 207 |
| Benzene, 1,2,3,4,5-pentabromo-6-(2,3,4,6-tetrabromophenoxy)- |
| 2,2 inverted exclamation marka,3,3 inverted exclamation marka,4,4 inverted exclamation marka,5,6,6 inverted exclamation marka-NonaBDE |
| 2,2`-OXYDLANILINE |
| 2,2 inverted exclamation marka,3,3 inverted exclamation marka,4,4 inverted exclamation marka,5,6,6 inverted exclamation marka-Nonabromodiphenyl ether solution |
| 1,2,3,4,5-Pentabromo-6-(2,3,4,6-tetrabromophenoxy)benzene |
| BDE No 207 solution |