1,2,3,4,5-Pentabromo-6-(2,3,5,6-tetrabromophenoxy)benzene structure
|
Common Name | 1,2,3,4,5-Pentabromo-6-(2,3,5,6-tetrabromophenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 437701-78-5 | Molecular Weight | 880.272 | |
| Density | 2.9±0.1 g/cm3 | Boiling Point | 543.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C12HBr9O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.4±28.6 °C | |
| Name | 1,2,3,4,5-Pentabromo-6-(2,3,5,6-tetrabromophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.0±50.0 °C at 760 mmHg |
| Molecular Formula | C12HBr9O |
| Molecular Weight | 880.272 |
| Flash Point | 228.4±28.6 °C |
| Exact Mass | 871.267700 |
| PSA | 9.23000 |
| LogP | 10.70 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.729 |
| InChIKey | ASGZXYIDLFWXID-UHFFFAOYSA-N |
| SMILES | Brc1cc(Br)c(Br)c(Oc2c(Br)c(Br)c(Br)c(Br)c2Br)c1Br |
|
~0%
1,2,3,4,5-Penta... CAS#:437701-78-5
Detail
|
| Literature: ALBEMARLE CORPORATION Patent: WO2008/27776 A2, 2008 ; Location in patent: Page/Page column 8-9 ; |
|
~0%
1,2,3,4,5-Penta... CAS#:437701-78-5 |
| Literature: ALBEMARLE CORPORATION Patent: WO2008/27776 A2, 2008 ; Location in patent: Page/Page column 9-10 ; |
|
~%
1,2,3,4,5-Penta... CAS#:437701-78-5 |
| Literature: Eriksson, Johan; Green, Nicholas; Marsh, Goeran; Bergman, Ake Environmental Science and Technology, 2004 , vol. 38, # 11 p. 3119 - 3125 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzene,pentabromo(2,3,5,6-tetrabromophenoxy) |
| 2,2',3,3',4,5,5',6,6'-nonabromodiphenyl ether |
| Benzene, 1,2,3,4,5-pentabromo-6-(2,3,5,6-tetrabromophenoxy)- |
| 1,2,3,4,5-Pentabromo-6-(2,3,5,6-tetrabromophenoxy)benzene |