4-Di-p-tolylamino-benzaldehyde structure
|
Common Name | 4-Di-p-tolylamino-benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 42906-19-4 | Molecular Weight | 301.382 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 470.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H19NO | Melting Point | 109 °C | |
| MSDS | N/A | Flash Point | 182.4±18.1 °C | |
| Name | 4-Formyl-4',4''-dimethyltriphenylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.5±45.0 °C at 760 mmHg |
| Melting Point | 109 °C |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.382 |
| Flash Point | 182.4±18.1 °C |
| Exact Mass | 301.146667 |
| PSA | 20.31000 |
| LogP | 6.14 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | XCGLXUJEPIVZJM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C=O)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26 |
| RTECS | UU7711500 |
| HS Code | 2922399090 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD03093257 |
| 4-(Di-p-tolylamino)benzaldehyde |
| 4-(Bis(p-tolyl)amino)benzaldehyde |
| Benzaldehyde, 4-[bis(4-methylphenyl)amino]- |
| 4-[Bis(4-methylphenyl)amino]benzaldehyde |
| 4-Di-p-tolylamino-benzaldehyde |
| 4-(4-methyl-N-(4-methylphenyl)anilino)benzaldehyde |
| 4-(Di-p-tolyl-amino)-benzaldehyde |
| Benzaldehyde, 4-(bis(4-methylphenyl)amino)- |
| 4,4'-Bis(4-methylphenyl)-aminobenzoaldehyde |
| EINECS 255-996-1 |
| (4-(Di-p-tolyamino)benzaldehyde) |