4-(di-m-Tolylamino)-benzaldehyde structure
|
Common Name | 4-(di-m-Tolylamino)-benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 332411-18-4 | Molecular Weight | 301.38200 | |
| Density | 1.138g/cm3 | Boiling Point | 470.5ºC at 760 mmHg | |
| Molecular Formula | C21H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | 4-(3-methyl-N-(3-methylphenyl)anilino)benzaldehyde |
|---|
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 470.5ºC at 760 mmHg |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.38200 |
| Flash Point | 182.4ºC |
| Exact Mass | 301.14700 |
| PSA | 20.31000 |
| LogP | 5.58570 |
| Index of Refraction | 1.649 |
| InChIKey | OLIQNHVNTIFEEX-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N(c2ccc(C=O)cc2)c2cccc(C)c2)c1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |