6-Bromo-N-methyl-2-naphthamide structure
|
Common Name | 6-Bromo-N-methyl-2-naphthamide | ||
|---|---|---|---|---|
| CAS Number | 426219-35-4 | Molecular Weight | 264.118 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 465.9±18.0 °C at 760 mmHg | |
| Molecular Formula | C12H10BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.6±21.2 °C | |
| Name | 6-Bromo-N-methyl-2-naphthamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 465.9±18.0 °C at 760 mmHg |
| Molecular Formula | C12H10BrNO |
| Molecular Weight | 264.118 |
| Flash Point | 235.6±21.2 °C |
| Exact Mass | 262.994568 |
| PSA | 29.10000 |
| LogP | 2.86 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | HPUCFMPIKISIIO-UHFFFAOYSA-N |
| SMILES | CNC(=O)c1ccc2cc(Br)ccc2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~91%
6-Bromo-N-methy... CAS#:426219-35-4 |
| Literature: WO2012/173280 A1, ; Page/Page column 32-33 ; |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-bromo-N-methylnaphthalene-2-carboxamide |
| 6-Bromo-N-methyl-2-naphthamide |
| 2-Naphthalenecarboxamide, 6-bromo-N-methyl- |