H-Tyr-OBzl structure
|
Common Name | H-Tyr-OBzl | ||
|---|---|---|---|---|
| CAS Number | 42406-77-9 | Molecular Weight | 271.311 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 438.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C16H17NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 219.1±25.9 °C | |
| Name | h-tyr-obzl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 438.7±35.0 °C at 760 mmHg |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.311 |
| Flash Point | 219.1±25.9 °C |
| Exact Mass | 271.120850 |
| PSA | 72.55000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | BVCTWRNVKLXEQC-HNNXBMFYSA-N |
| SMILES | NC(Cc1ccc(O)cc1)C(=O)OCc1ccccc1 |
| Storage condition | Store at RT. |
| HS Code | 2922509090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Tyrosine, phenylmethyl ester |
| L-TRP-GLY |
| TRP-GLY CRYSTALLINE |
| tryptophylglycine |
| L-tryptophyl-Glycine |
| Tyr(OH)-OBn |
| L-tyrosine benzyl ester |
| [(1S)-endo]-borneyl 4-hydroxybenzoate |
| l-tschimgin |
| N-L-Tryptophylglycine |
| TRP-GLY |
| Trp-Gly-OH |
| L-Tyrosin-benzylester |
| Benzyl L-tyrosinate |
| tryptylglycine |
| L-Trp-Gly-OH |