(1H-Benzo[d][1,2,3]triazol-1-yl)(phenyl)methanone structure
|
Common Name | (1H-Benzo[d][1,2,3]triazol-1-yl)(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 4231-62-3 | Molecular Weight | 223.23000 | |
| Density | 1.28g/cm3 | Boiling Point | 404.9ºC at 760 mmHg | |
| Molecular Formula | C13H9N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.7ºC | |
| Name | benzotriazol-1-yl(phenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 404.9ºC at 760 mmHg |
| Molecular Formula | C13H9N3O |
| Molecular Weight | 223.23000 |
| Flash Point | 198.7ºC |
| Exact Mass | 223.07500 |
| PSA | 47.78000 |
| LogP | 2.11980 |
| Index of Refraction | 1.68 |
| InChIKey | UJEMOXPSTTXLRE-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)n1nnc2ccccc21 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2933990090 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00451114 |
| (1H-1,2,3-benzotriazol-1-yl)(phenyl)methanone |
| benzotriazolyl phenyl ketone |
| Benzotriazol-1-yl-phenyl-methanone |
| 1-Benzoyl-1H-benzotriazole |
| 1H-1,2,3-benzotriazol-1-yl(phenyl)metanone |
| (1H-benzo[d][1,2,3]triazol-1-yl)(phenyl)methanone |
| 1-Benzoylbenzotriazole |
| (1H-benzotriazol-1-yl)(phenyl)methanone |
| 1-(1H-1,2,3-benzotriazol-1-yl)(phenyl)methanone |