Testosterone β-D-Glucuronide Monosodium Salt
Modify Date: 2025-08-25 15:40:42
Testosterone β-D-Glucuronide Monosodium Salt structure
|
Common Name | Testosterone β-D-Glucuronide Monosodium Salt | ||
|---|---|---|---|---|
| CAS Number | 4145-59-9 | Molecular Weight | 486.53000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H35NaO8 | Melting Point | 287-290ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Warning | |
| Name | Testosterone β-D-Glucuronide Monosodium Salt |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 287-290ºC (dec.) |
|---|---|
| Molecular Formula | C25H35NaO8 |
| Molecular Weight | 486.53000 |
| Exact Mass | 486.22300 |
| PSA | 136.35000 |
| LogP | 0.46100 |
| InChIKey | JUXKYFINRYJTDA-XHPOIRKISA-M |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C(OC3OC(C(=O)[O-])C(O)C(O)C3O)CCC12.[Na+] |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H332-H351 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 20/21/22-40 |
| Safety Phrases | 22-36 |
| RIDADR | NONH for all modes of transport |
|
On-line drug-metabolism system using microsomes encapsulated in a capillary by the sol-gel method and integrated into capillary electrophoresis.
Anal. Biochem. 308(2) , 278-84, (2002) A novel microsome-encapsulation technique using the sol-gel method was developed for the on-line drug-metabolism analytical system integrated into capillary electrophoresis. This analytical system all... |
| 17beta-hydroxy-4-androsten-3-one 17-d-glucuronide sodium salt |
| MFCD00083509 |