Estrone β-D-Glucuronide Sodium Salt structure
|
Common Name | Estrone β-D-Glucuronide Sodium Salt | ||
|---|---|---|---|---|
| CAS Number | 15087-01-1 | Molecular Weight | 468.47200 | |
| Density | N/A | Boiling Point | 703.8ºC at 760 mmHg | |
| Molecular Formula | C24H29NaO8 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 242.9ºC | |
| Name | Estrone β-D-Glucuronide Sodium Salt |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 703.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H29NaO8 |
| Molecular Weight | 468.47200 |
| Flash Point | 242.9ºC |
| Exact Mass | 468.17600 |
| PSA | 136.35000 |
| LogP | 0.04810 |
| Vapour Pressure | 8.67E-21mmHg at 25°C |
| InChIKey | PBULYLQKWDXDFZ-QHIGSJCSSA-M |
| SMILES | CC12CCC3c4ccc(OC5OC(C(=O)[O-])C(O)C(O)C5O)cc4CCC3C1CCC2=O.[Na+] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Adenine nucleotide translocator cooperates with core cell death machinery to promote apoptosis in Caenorhabditis elegans.
Mol. Cell. Biol. 29 , 3881-93, (2009) In Caenorhabditis elegans, the central cell-killing process is essentially controlled by the interplay of four apoptotic factors: EGL-1/BH3-only protein, CED-9/Bcl2, CED-4/Apaf1, and CED-3/caspase. In... |
| sodium,(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-2-carboxylate |