4-hydroxy-3-pentylnaphthalene-1,2-dione
Modify Date: 2025-10-08 12:43:27
4-hydroxy-3-pentylnaphthalene-1,2-dione structure
|
Common Name | 4-hydroxy-3-pentylnaphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 41245-53-8 | Molecular Weight | 244.28600 | |
| Density | 1.205g/cm3 | Boiling Point | 397.3ºC at 760 mmHg | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.3ºC | |
| Name | 4-hydroxy-3-pentylnaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 397.3ºC at 760 mmHg |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.28600 |
| Flash Point | 208.3ºC |
| Exact Mass | 244.11000 |
| PSA | 54.37000 |
| LogP | 3.30140 |
| Index of Refraction | 1.582 |
| InChIKey | ZUNQUTHYWNTGHA-UHFFFAOYSA-N |
| SMILES | CCCCCC1=C(O)c2ccccc2C(=O)C1=O |
|
~%
4-hydroxy-3-pen... CAS#:41245-53-8 |
| Literature: Fieser et al. Journal of the American Chemical Society, 1948 , vol. 70, p. 3177 |
| 2-hydroxy-3-pentyl-[1,4]naphthoquinone |
| 2-Hydroxy-3-pentyl-[1,4]naphthochinon |
| 2-hydroxy-3-n-pentyl-1,4-naphthoquinone |
| HMS1579F11 |