Methyl 4-acetamido-2-methoxybenzoate structure
|
Common Name | Methyl 4-acetamido-2-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 4093-29-2 | Molecular Weight | 223.225 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 417.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | 127ºC | |
| MSDS | N/A | Flash Point | 206.3±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Methyl 4-acetamido-2-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 417.5±35.0 °C at 760 mmHg |
| Melting Point | 127ºC |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.225 |
| Flash Point | 206.3±25.9 °C |
| Exact Mass | 223.084457 |
| PSA | 64.63000 |
| LogP | 1.89 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | OERVVBDWGVOBIS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(NC(C)=O)cc1OC |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P301 + P312 + P330-P305 + P351 + P338 |
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
| HS Code | 2942000000 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-acetamido-2-methoxybenzoic acid methyl ester |
| 4-(acetylamino)-2-methoxy-benzoic acid,methyl ester |
| methyl 4-(acetylamino)-o-anisate |
| methyl-4-acetamido-2-methoxybenzoate |
| Benzoic acid, 4-(acetylamino)-2-methoxy-, methyl ester |
| Methyl 4-acetamido-2-methoxybenzoate |
| methyl 2-methoxy-4-acetamidobenzoate |
| MFCD00065258 |
| methyl 4-(acetylamino)-2-methoxybenzoate |
| EINECS 223-839-6 |