DL-Carnitine structure
|
Common Name | DL-Carnitine | ||
|---|---|---|---|---|
| CAS Number | 406-76-8 | Molecular Weight | 161.199 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DL-CarnitineDL-Carnitine is a racemic mixture of L-Carnitine and D-Carnitine, regulates fatty acid transport in mitochondria, elevates serum carnitine fractions. |
| Name | carnitinium |
|---|---|
| Synonym | More Synonyms |
| Description | DL-Carnitine is a racemic mixture of L-Carnitine and D-Carnitine, regulates fatty acid transport in mitochondria, elevates serum carnitine fractions. |
|---|---|
| Related Catalog |
| Molecular Formula | C7H15NO3 |
|---|---|
| Molecular Weight | 161.199 |
| Exact Mass | 161.105194 |
| PSA | 60.36000 |
| LogP | -4.52 |
| InChIKey | PHIQHXFUZVPYII-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CC(O)CC(=O)[O-] |
| Storage condition | 2-8℃ |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2923900090 |
|---|
|
~%
Detail
|
| Literature: Hanselmann, Paul; Klegraf, Ellen; Elzner, Stephan; Quittmann, Wilhelm; Fischer, Daniel Friedrich Patent: US2012/22275 A1, 2012 ; Location in patent: Page/Page column 10 ; |
|
~%
DL-Carnitine CAS#:406-76-8 |
| Literature: Jain, Rajendra P; Williams, Robert M Tetrahedron, 2001 , vol. 57, # 30 p. 6505 - 6509 |
|
~80%
DL-Carnitine CAS#:406-76-8 |
| Literature: Bellamy; Bondoux; Dodey Tetrahedron Letters, 1990 , vol. 31, # 50 p. 7323 - 7326 |
|
~%
DL-Carnitine CAS#:406-76-8 |
| Literature: Fuganti, Claudio; Grasselli, Piero Tetrahedron Letters, 1985 , vol. 26, # 1 p. 101 - 104 |
|
~%
DL-Carnitine CAS#:406-76-8 |
| Literature: Bose, D. Subhas; Fatima, Liyakat; Rajender, Salla Synthesis, 2006 , # 11 p. 1863 - 1867 |
|
~%
DL-Carnitine CAS#:406-76-8 |
| Literature: Berthod; Valleix; Tizon; Leonce; Caussignac; Armstrong Analytical Chemistry, 2001 , vol. 73, # 22 p. 5499 - 5508 |
|
~%
DL-Carnitine CAS#:406-76-8 |
| Literature: Mueller; Strack Hoppe-Seyler's Zeitschrift fuer physiologische Chemie, 1972 , vol. 353, # 4 p. 618 - 622 |
|
~%
DL-Carnitine CAS#:406-76-8 |
| Literature: Bernabei, Ida; Castagnani, Roberto; Angelis, Francesco De; Witt Scalfaro, Paolo De; Giannessi, Fabio; et al. Angewandte Chemie, 1994 , vol. 106, # 20 p. 2202 - 2203 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| L-(-)-Carnitine |
| (-)-L-Carnitin |
| 3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium Hydroxide Inner Salt |
| L(-)-Carnitine |
| (R)-Carnitine |
| Carnitine, L- |
| 3-Hydroxy-4-trimethylammoniobutanoate |
| UNII:S7UI8SM58A |
| (L-3-Carboxy-2-hydroxypropyl)trimethylammonium hydroxide inner salt |
| Ammonium, (3-carboxy-2-hydroxypropyl)trimethyl-, hydroxide, inner salt, L- |
| Carnitine DL-form |
| L-Carnitine |
| BICARNESINE |
| 3-Hydroxy-4-(trimethylammonio)butanoate |
| Cardiogen |
| g-Trimethylammonium-b-hydroxybutirate |
| 4-Copab |
| Monocamin |
| L-Carnitine inner salt |
| 1-Propanaminium, 3-carboxy-2-hydroxy-N,N,N-trimethyl-, inner salt |
| g-Trimethyl-b-hydroxybutyrobetaine |
| (-)-Carnitine |
| (3R)-3-Hydroxy-4-(trimethylammonio)butanoate |
| DL-Carnitine |
| (-)-(R)-3-Hydroxy-4-(trimethylammonio)butyrate |
| carnitine (L-form) |
| Levocarnitine |
| g-Amino-b-hydroxybutyric Acid Trimethylbetaine |
| (R)-3-Carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium hydroxide inner salt |
| (−)-(R)-3-Hydroxy-4-(trimethylammonio)butyrate |
| γ-Trimethyl-β-hydroxybutyrobetaine |
| Carnitine, (-)- |
| D,L-carnitine |
| (±)-carnitine |
| 1-Propanaminium, 3-carboxy-2-hydroxy-N,N,N-trimethyl-, inner salt, (2R)- |
| carnitine |