Pigment Red 177 structure
|
Common Name | Pigment Red 177 | ||
|---|---|---|---|---|
| CAS Number | 4051-63-2 | Molecular Weight | 340.375 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 601.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H16N2O2 | Melting Point | 356-358ºC | |
| MSDS | N/A | Flash Point | 221.4±31.7 °C | |
| Name | Pigment Red 177 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 601.6±55.0 °C at 760 mmHg |
| Melting Point | 356-358ºC |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.375 |
| Flash Point | 221.4±31.7 °C |
| Exact Mass | 340.121185 |
| PSA | 120.32000 |
| LogP | 3.45 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | KNMQFBWXSICVQC-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2ccc(N)c3c2C(=O)c2ccccc2C3=O)c2c1C(=O)c1ccccc1C2=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922399090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Cromophtal Red A-3B |
| 5,12-Dihydro-2,9-dimethylquino[2,3-b]acridine-7,14-dione |
| 4,4'-Diamino-1,1'-bianthraquinone |
| Quino[2,3-b]acridine-7,14-dione, 5,12-dihydro-2,9-dimethyl- |
| 2,9-Dimethylquinacridone |
| 2,9-Dimethylquinolino[2,3-b]acridine-7,14(5H,12H)-dione |
| Fast Red A3B |
| Permanent Red A3B |
| T G6 E6 C666 BM FQ MM QVJ I1 T1 |
| ANTHRAQUINONE RED |
| 4,4'-Diamino-1,1'-dianthrquinonyl |
| 2,9-Dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
| 4,4'-Diamino-1,1'-bianthraquinonyl |