6-(2-benzo[1,3]dioxol-5-ylethenyl)pteridine-2,4-diamine structure
|
Common Name | 6-(2-benzo[1,3]dioxol-5-ylethenyl)pteridine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 40110-63-2 | Molecular Weight | 308.29500 | |
| Density | 1.577g/cm3 | Boiling Point | 614.4ºC at 760 mmHg | |
| Molecular Formula | C15H12N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.4ºC | |
| Name | 6-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]pteridine-2,4-diamine |
|---|
| Density | 1.577g/cm3 |
|---|---|
| Boiling Point | 614.4ºC at 760 mmHg |
| Molecular Formula | C15H12N6O2 |
| Molecular Weight | 308.29500 |
| Flash Point | 325.4ºC |
| Exact Mass | 308.10200 |
| PSA | 122.06000 |
| LogP | 2.64570 |
| Index of Refraction | 1.866 |
| InChIKey | VWHZHTYRPRNUHS-HNQUOIGGSA-N |
| SMILES | Nc1nc(N)c2nc(C=Cc3ccc4c(c3)OCO4)cnc2n1 |
|
~%
6-(2-benzo[1,3]... CAS#:40110-63-2 |
| Literature: Taylor,E.C.; Kobayashi,T. Journal of Organic Chemistry, 1973 , vol. 38, p. 2817 - 2821 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |