1,2-BIS(3-METHOXYPHENYL)ETHANE-1,2-DIONE structure
|
Common Name | 1,2-BIS(3-METHOXYPHENYL)ETHANE-1,2-DIONE | ||
|---|---|---|---|---|
| CAS Number | 40101-17-5 | Molecular Weight | 270.28000 | |
| Density | 1.183 g/cm3 | Boiling Point | 442.2ºC at 760 mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | 82-84ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 197.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3,3'-dimethoxybenzil |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183 g/cm3 |
|---|---|
| Boiling Point | 442.2ºC at 760 mmHg |
| Melting Point | 82-84ºC(lit.) |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 197.5ºC |
| Exact Mass | 270.08900 |
| PSA | 52.60000 |
| LogP | 2.76940 |
| Index of Refraction | 1.566 |
| InChIKey | PJGXOGKIVAJFTE-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)C(=O)c2cccc(OC)c2)c1 |
| Water Solubility | Insoluble in water. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914509090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Conformational Disorder Enhances Solubility and Photovoltaic Performance of a Thiophene-Quinoxaline Copolymer. Wang E, et al.
Adv. Energy Mater. 3(6) , 806-14, (2013)
|
|
|
Modelling dynamic disorder in 3, 3'-dimethoxybenzil, C16H14O4. Goossens DJ, et al.
Proceedings of the 16th Australian Institute of Physics Congress , (2005)
|
| bis(3-methoxyphenyl)ethanedione |
| 1,2-bis(3-methoxyphenyl)ethandione |
| Ethanedione,bis(3-methoxyphenyl) |
| MFCD00038221 |
| 3,3'dimethoxybenzil |
| 1,2-bis(3-methoxyphenyl)-1,2-ethandione |
| EINECS 254-793-5 |
| Bis(3-methoxyphenyl) diketone |
| 1,2-Bis(3-methoxyphenyl)-1,2-ethanedione |
| 1,2-Bis-(3-methoxy-phenyl)-ethan-1,2-dion |
| 1,2-Bis(3-methoxyphenyl)ethane-1,2-dione |
| m-methoxybenzil |
| 3,3-Dimethoxydibenzoyl |