2-hydroxy-1,2-bis(3-methoxyphenyl)propan-1-one structure
|
Common Name | 2-hydroxy-1,2-bis(3-methoxyphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 111914-72-8 | Molecular Weight | 286.32200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-1,2-bis(3-methoxyphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18O4 |
|---|---|
| Molecular Weight | 286.32200 |
| Exact Mass | 286.12100 |
| PSA | 55.76000 |
| LogP | 2.79420 |
| InChIKey | WDTYFIUFFFBJPR-UHFFFAOYSA-N |
| SMILES | COc1cccc(C(=O)C(C)(O)c2cccc(OC)c2)c1 |
|
~29%
2-hydroxy-1,2-b... CAS#:111914-72-8 |
| Literature: Miura, Masahiro; Akase, Fumiaki; Shinohara, Masato; Nomura, Masakatsu Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 1021 - 1026 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Propanone,2-hydroxy-1,2-bis(3-methoxyphenyl) |